C20H20FN3O2S — CID 42287930
6-(4-fluorophenyl)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 42287930) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 42287930 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 6-(4-fluorophenyl)-N-(2-hydroxy-2-prop-2-enylpent-4-enyl)imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C=CCC(O)(CC=C)CNC(=O)c1csc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C20H20FN3O2S/c1-3-9-20(26,10-4-2)13-22-18(25)17-12-27-19-23-16(11-24(17)19)14-5-7-15(21)8-6-14/h3-8,11-12,26H,1-2,9-10,13H2,(H,22,25) |
| InChIKey | QZABIJUDWMHGRX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|