About 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one
3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 4228855) has the molecular formula C17H16N2O3S
and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 4228855 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(N2C(=O)CSC2c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H16N2O3S/c1-11-7-12(2)9-15(8-11)18-16(20)10-23-17(18)13-3-5-14(6-4-13)19(21)22/h3-9,17H,10H2,1-2H3 |
| InChIKey | UIHVNJZXRFNESI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one (CID 4228855) is 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one is Cc1cc(C)cc(N2C(=O)CSC2c2ccc([N+](=O)[O-])cc2)c1.
What is the InChIKey of 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one?
The InChIKey is UIHVNJZXRFNESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3S/c1-11-7-12(2)9-15(8-11)18-16(20)10-23-17(18)13-3-5-14(6-4-13)19(21)22/h3-9,17H,10H2,1-2H3.
What are the key properties of 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one?
3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one has a molecular weight of 328.39 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 4228855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).