C26H29F5N4O3 — CID 4228983
[3-(4-ethylpiperazine-1-carbonyl)-5-(2,3,4,5,6-pentafluorophenoxy)phenyl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 4228983) has the molecular formula C26H29F5N4O3 and a molecular weight of 540.53 g/mol. Its IUPAC name is [3-(4-ethylpiperazine-1-carbonyl)-5-(2,3,4,5,6-pentafluorophenoxy)phenyl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [3-(4-ethylpiperazine-1-carbonyl)-5-(2,3,4,5,6-pentafluorophenoxy)phenyl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4228983 |
| Molecular Formula | C26H29F5N4O3 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | [3-(4-ethylpiperazine-1-carbonyl)-5-(2,3,4,5,6-pentafluorophenoxy)phenyl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cc(Oc3c(F)c(F)c(F)c(F)c3F)cc(C(=O)N3CCN(CC)CC3)c2)CC1 |
| InChI | InChI=1S/C26H29F5N4O3/c1-3-32-5-9-34(10-6-32)25(36)16-13-17(26(37)35-11-7-33(4-2)8-12-35)15-18(14-16)38-24-22(30)20(28)19(27)21(29)23(24)31/h13-15H,3-12H2,1-2H3 |
| InChIKey | ZIHQMVXHJRVGQI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|