C21H21N3O2 — CID 42292827
[(3R)-3-anilinopiperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone (PubChem CID 42292827) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is [(3R)-3-anilinopiperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(3R)-3-anilinopiperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 42292827 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | [(3R)-3-anilinopiperidin-1-yl]-(5-phenyl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)on1)N1CCC[C@@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H21N3O2/c25-21(19-14-20(26-23-19)16-8-3-1-4-9-16)24-13-7-12-18(15-24)22-17-10-5-2-6-11-17/h1-6,8-11,14,18,22H,7,12-13,15H2/t18-/m1/s1 |
| InChIKey | OOSYXCRTMIFMGB-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |