C10H6F4N4O2S2 — CID 4229322
2,2,3,3-tetrafluoro-N,N'-bis(1,3-thiazol-2-yl)butanediamide (PubChem CID 4229322) has the molecular formula C10H6F4N4O2S2 and a molecular weight of 354.31 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N'-bis(1,3-thiazol-2-yl)butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N'-bis(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 4229322 |
| Molecular Formula | C10H6F4N4O2S2 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N'-bis(1,3-thiazol-2-yl)butanediamide |
| SMILES | O=C(Nc1nccs1)C(F)(F)C(F)(F)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C10H6F4N4O2S2/c11-9(12,5(19)17-7-15-1-3-21-7)10(13,14)6(20)18-8-16-2-4-22-8/h1-4H,(H,15,17,19)(H,16,18,20) |
| InChIKey | FSSXCGRLTKYSEF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|