C18H11N2O4S2- — CID 4229633
4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate (PubChem CID 4229633) has the molecular formula C18H11N2O4S2- and a molecular weight of 383.43 g/mol. Its IUPAC name is 4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate.
| Compound Name | 4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 4229633 |
| Molecular Formula | C18H11N2O4S2- |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 4-[(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]benzoate |
| SMILES | O=C([O-])c1ccc(C=C2SC(=S)N(NC(=O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H12N2O4S2/c21-15(12-4-2-1-3-5-12)19-20-16(22)14(26-18(20)25)10-11-6-8-13(9-7-11)17(23)24/h1-10H,(H,19,21)(H,23,24)/p-1 |
| InChIKey | LODNXHBSRNISDP-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|