About 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine
4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine (PubChem CID 4229824) has the molecular formula C27H35N3
and a molecular weight of 401.60 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine |
| PubChem CID | 4229824 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine |
| SMILES | CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-c3cc(C(C)(C)C)ccn3)n2)c1 |
| InChI | InChI=1S/C27H35N3/c1-25(2,3)18-10-12-28-21(14-18)23-16-20(27(7,8)9)17-24(30-23)22-15-19(11-13-29-22)26(4,5)6/h10-17H,1-9H3 |
| InChIKey | QMABMHJGSFUTPF-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
The IUPAC name of 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine (CID 4229824) is 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine.
What is the SMILES notation for 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
The canonical SMILES for 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine is CC(C)(C)c1ccnc(-c2cc(C(C)(C)C)cc(-c3cc(C(C)(C)C)ccn3)n2)c1.
What is the InChIKey of 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
The InChIKey is QMABMHJGSFUTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35N3/c1-25(2,3)18-10-12-28-21(14-18)23-16-20(27(7,8)9)17-24(30-23)22-15-19(11-13-29-22)26(4,5)6/h10-17H,1-9H3.
What are the key properties of 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine?
4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine has a molecular weight of 401.60 g/mol, XLogP of 7.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-bis(4-tert-butyl-2-pyridinyl)pyridine is sourced from PubChem (CID 4229824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).