About 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one
1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one (PubChem CID 4229850) has the molecular formula C21H26N2O2S
and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one |
| PubChem CID | 4229850 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone |
| SMILES | CC1=CC=C(C=C1)CSCC(=O)N2CCN(CC2)C3=CC=C(C=C3)OC |
| InChI | InChI=1S/C21H26N2O2S/c1-17-3-5-18(6-4-17)15-26-16-21(24)23-13-11-22(12-14-23)19-7-9-20(25-2)10-8-19/h3-10H,11-16H2,1-2H3 |
| InChIKey | IQMPCTGLUBOTIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 424 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one?
The IUPAC name of 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one (CID 4229850) is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-methylphenyl)methylsulfanyl]ethanone.
What is the SMILES notation for 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one?
The canonical SMILES for 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one is CC1=CC=C(C=C1)CSCC(=O)N2CCN(CC2)C3=CC=C(C=C3)OC.
What is the InChIKey of 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one?
The InChIKey is IQMPCTGLUBOTIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2S/c1-17-3-5-18(6-4-17)15-26-16-21(24)23-13-11-22(12-14-23)19-7-9-20(25-2)10-8-19/h3-10H,11-16H2,1-2H3.
What are the key properties of 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one?
1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one has a molecular weight of 370.50 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-Methoxyphenyl)piperazin-1-YL]-2-{[(4-methylphenyl)methyl]sulfanyl}ethan-1-one is sourced from PubChem (CID 4229850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).