About [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone
[3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 42300984) has the molecular formula C23H26N4O3
and a molecular weight of 406.49 g/mol. Its IUPAC name is [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 42300984 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cccc(OC2CCN(Cc3cccc4nonc34)CC2)c1)N1CCCC1 |
| InChI | InChI=1S/C23H26N4O3/c28-23(27-11-1-2-12-27)17-5-3-7-20(15-17)29-19-9-13-26(14-10-19)16-18-6-4-8-21-22(18)25-30-24-21/h3-8,15,19H,1-2,9-14,16H2 |
| InChIKey | NFWFRXPYPWBDLF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone (CID 42300984) is [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone is O=C(c1cccc(OC2CCN(Cc3cccc4nonc34)CC2)c1)N1CCCC1.
What is the InChIKey of [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone?
The InChIKey is NFWFRXPYPWBDLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O3/c28-23(27-11-1-2-12-27)17-5-3-7-20(15-17)29-19-9-13-26(14-10-19)16-18-6-4-8-21-22(18)25-30-24-21/h3-8,15,19H,1-2,9-14,16H2.
What are the key properties of [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone?
[3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone has a molecular weight of 406.49 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-(2,1,3-benzoxadiazol-4-ylmethyl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 42300984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).