About (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one
(3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one (PubChem CID 42303356) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one.
Molecular Properties
| Compound Name | (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one |
| PubChem CID | 42303356 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one |
| SMILES | CC[C@]1(C)NC(C)(C)COC1=O |
| InChI | InChI=1S/C9H17NO2/c1-5-9(4)7(11)12-6-8(2,3)10-9/h10H,5-6H2,1-4H3/t9-/m0/s1 |
| InChIKey | KGKBDJTUKBJFEU-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one?
The IUPAC name of (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one (CID 42303356) is (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one.
What is the SMILES notation for (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one?
The canonical SMILES for (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one is CC[C@]1(C)NC(C)(C)COC1=O.
What is the InChIKey of (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one?
The InChIKey is KGKBDJTUKBJFEU-VIFPVBQESA-N. The full InChI is InChI=1S/C9H17NO2/c1-5-9(4)7(11)12-6-8(2,3)10-9/h10H,5-6H2,1-4H3/t9-/m0/s1.
What are the key properties of (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one?
(3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one has a molecular weight of 171.24 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethyl-3,5,5-trimethylmorpholin-2-one is sourced from PubChem (CID 42303356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).