C21H19N5O6S4 — CID 4230985
2,3-dimethoxy-N-[5-[2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 4230985) has the molecular formula C21H19N5O6S4 and a molecular weight of 565.68 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[5-[2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,3-dimethoxy-N-[5-[2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4230985 |
| Molecular Formula | C21H19N5O6S4 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | 2,3-dimethoxy-N-[5-[2-[(6-methylsulfonyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2nnc(SCC(=O)Nc3nc4ccc(S(C)(=O)=O)cc4s3)s2)c1OC |
| InChI | InChI=1S/C21H19N5O6S4/c1-31-14-6-4-5-12(17(14)32-2)18(28)24-20-25-26-21(35-20)33-10-16(27)23-19-22-13-8-7-11(36(3,29)30)9-15(13)34-19/h4-9H,10H2,1-3H3,(H,22,23,27)(H,24,25,28) |
| InChIKey | UZMTXYBQKHKADN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|