C17H20FN3OS — CID 42310649
[(3R)-3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 42310649) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is [(3R)-3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [(3R)-3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 42310649 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [(3R)-3-[2-(2-fluorophenyl)ethyl]piperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCC[C@@H](CCc2ccccc2F)C1 |
| InChI | InChI=1S/C17H20FN3OS/c1-12-16(23-20-19-12)17(22)21-10-4-5-13(11-21)8-9-14-6-2-3-7-15(14)18/h2-3,6-7,13H,4-5,8-11H2,1H3/t13-/m0/s1 |
| InChIKey | YTXHFUSRRDQYFZ-ZDUSSCGKSA-N |
| XLogP | 3.47 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |