About 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione
3,6-dioxabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 4231377) has the molecular formula C4H2O4
and a molecular weight of 114.06 g/mol. Its IUPAC name is 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione.
Molecular Properties
| Compound Name | 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
| PubChem CID | 4231377 |
| Molecular Formula | C4H2O4 |
| Molecular Weight | 114.06 g/mol |
| Exact Mass | 114.00 |
| IUPAC Name | 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1OC(=O)C2OC12 |
| InChI | InChI=1S/C4H2O4/c5-3-1-2(7-1)4(6)8-3/h1-2H |
| InChIKey | ILABOOGTVTXVFN-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.06 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
The IUPAC name of 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione (CID 4231377) is 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione.
What is the SMILES notation for 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
The canonical SMILES for 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is O=C1OC(=O)C2OC12.
What is the InChIKey of 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
The InChIKey is ILABOOGTVTXVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O4/c5-3-1-2(7-1)4(6)8-3/h1-2H.
What are the key properties of 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione?
3,6-dioxabicyclo[3.1.0]hexane-2,4-dione has a molecular weight of 114.06 g/mol, XLogP of -1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dioxabicyclo[3.1.0]hexane-2,4-dione is sourced from PubChem (CID 4231377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).