About (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone
(2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 4231415) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone |
| PubChem CID | 4231415 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C(C)CCCC2C)no1 |
| InChI | InChI=1S/C12H18N2O2/c1-8-5-4-6-9(2)14(8)12(15)11-7-10(3)16-13-11/h7-9H,4-6H2,1-3H3 |
| InChIKey | KNUSTMSNVGBGPV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
The IUPAC name of (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone (CID 4231415) is (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone.
What is the SMILES notation for (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
The canonical SMILES for (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone is Cc1cc(C(=O)N2C(C)CCCC2C)no1.
What is the InChIKey of (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
The InChIKey is KNUSTMSNVGBGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-8-5-4-6-9(2)14(8)12(15)11-7-10(3)16-13-11/h7-9H,4-6H2,1-3H3.
What are the key properties of (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone?
(2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone has a molecular weight of 222.29 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylpiperidin-1-yl)-(5-methyl-1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 4231415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).