C11H7F7N2O4 — CID 4231728
2,2,3,3,4,4,4-heptafluoro-N-(4-methoxy-2-nitrophenyl)butanamide (PubChem CID 4231728) has the molecular formula C11H7F7N2O4 and a molecular weight of 364.17 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(4-methoxy-2-nitrophenyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(4-methoxy-2-nitrophenyl)butanamide |
|---|---|
| PubChem CID | 4231728 |
| Molecular Formula | C11H7F7N2O4 |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(4-methoxy-2-nitrophenyl)butanamide |
| SMILES | COc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H7F7N2O4/c1-24-5-2-3-6(7(4-5)20(22)23)19-8(21)9(12,13)10(14,15)11(16,17)18/h2-4H,1H3,(H,19,21) |
| InChIKey | SHNODLVFILNWJR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|