C11H15ClO4 — CID 4231776
(7-chloro-3a-methyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-4-yl) acetate (PubChem CID 4231776) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is (7-chloro-3a-methyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-4-yl) acetate.
| Compound Name | (7-chloro-3a-methyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-4-yl) acetate |
|---|---|
| PubChem CID | 4231776 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (7-chloro-3a-methyl-3-oxo-1,4,5,6,7,7a-hexahydro-2-benzofuran-4-yl) acetate |
| SMILES | CC(=O)OC1CCC(Cl)C2COC(=O)C12C |
| InChI | InChI=1S/C11H15ClO4/c1-6(13)16-9-4-3-8(12)7-5-15-10(14)11(7,9)2/h7-9H,3-5H2,1-2H3 |
| InChIKey | LZUQGRVLHWNWOX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|