C20H23N3O4 — CID 42319295
1-[9-methoxy-7-(6-methoxypyridazin-3-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pent-4-en-1-one (PubChem CID 42319295) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[9-methoxy-7-(6-methoxypyridazin-3-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pent-4-en-1-one.
| Compound Name | 1-[9-methoxy-7-(6-methoxypyridazin-3-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 42319295 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[9-methoxy-7-(6-methoxypyridazin-3-yl)-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCOc2c(cc(-c3ccc(OC)nn3)cc2OC)C1 |
| InChI | InChI=1S/C20H23N3O4/c1-4-5-6-19(24)23-9-10-27-20-15(13-23)11-14(12-17(20)25-2)16-7-8-18(26-3)22-21-16/h4,7-8,11-12H,1,5-6,9-10,13H2,2-3H3 |
| InChIKey | CQABQLXMBKKBOL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|