C24H24N2O6 — CID 42319590
N-cyclopropyl-N-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]phenyl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42319590) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is N-cyclopropyl-N-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]phenyl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-cyclopropyl-N-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]phenyl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42319590 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-cyclopropyl-N-[[4-[2-(2,5-dioxopyrrolidin-1-yl)ethoxy]phenyl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C1CCC(=O)N1CCOc1ccc(CN(C(=O)c2ccc3c(c2)OCO3)C2CC2)cc1 |
| InChI | InChI=1S/C24H24N2O6/c27-22-9-10-23(28)25(22)11-12-30-19-6-1-16(2-7-19)14-26(18-4-5-18)24(29)17-3-8-20-21(13-17)32-15-31-20/h1-3,6-8,13,18H,4-5,9-12,14-15H2 |
| InChIKey | GGVGYZMCBHLSHQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|