C23H23N5O4S — CID 42319780
10-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-9-methoxy-3-(1,2,5-thiadiazole-3-carbonyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one (PubChem CID 42319780) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is 10-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-9-methoxy-3-(1,2,5-thiadiazole-3-carbonyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one.
| Compound Name | 10-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-9-methoxy-3-(1,2,5-thiadiazole-3-carbonyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 42319780 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 10-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-9-methoxy-3-(1,2,5-thiadiazole-3-carbonyl)-1,2,4,5-tetrahydropyrido[1,2-d][1,4]diazepin-7-one |
| SMILES | COc1cc(=O)n2c(c1C(=O)N1CCc3ccccc3C1)CCN(C(=O)c1cnsn1)CC2 |
| InChI | InChI=1S/C23H23N5O4S/c1-32-19-12-20(29)28-11-10-26(22(30)17-13-24-33-25-17)9-7-18(28)21(19)23(31)27-8-6-15-4-2-3-5-16(15)14-27/h2-5,12-13H,6-11,14H2,1H3 |
| InChIKey | MNARXHDSZFSALI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |