C31H24FN7O4S2 — CID 4232099
N-[[5-[2-[3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 4232099) has the molecular formula C31H24FN7O4S2 and a molecular weight of 641.71 g/mol. Its IUPAC name is N-[[5-[2-[3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | N-[[5-[2-[3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 4232099 |
| Molecular Formula | C31H24FN7O4S2 |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | N-[[5-[2-[3-(4-fluorophenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-4-(4-nitrophenyl)-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | O=C(NCc1nnc(SCC(=O)N2N=C(c3cccs3)CC2c2ccc(F)cc2)n1-c1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C31H24FN7O4S2/c32-22-10-8-20(9-11-22)26-17-25(27-7-4-16-44-27)36-38(26)29(40)19-45-31-35-34-28(18-33-30(41)21-5-2-1-3-6-21)37(31)23-12-14-24(15-13-23)39(42)43/h1-16,26H,17-19H2,(H,33,41) |
| InChIKey | OAZMONYZBCQRSK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|