C17H9F7N2 — CID 4232416
2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenylquinoxaline (PubChem CID 4232416) has the molecular formula C17H9F7N2 and a molecular weight of 374.26 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenylquinoxaline.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenylquinoxaline |
|---|---|
| PubChem CID | 4232416 |
| Molecular Formula | C17H9F7N2 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenylquinoxaline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1nc2ccccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C17H9F7N2/c18-15(19,16(20,21)17(22,23)24)14-13(10-6-2-1-3-7-10)25-11-8-4-5-9-12(11)26-14/h1-9H |
| InChIKey | YSCIJIDFVAKDBE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|