C36H55NO3 — CID 4232451
[5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone (PubChem CID 4232451) has the molecular formula C36H55NO3 and a molecular weight of 549.84 g/mol. Its IUPAC name is [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone.
| Compound Name | [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 4232451 |
| Molecular Formula | C36H55NO3 |
| Molecular Weight | 549.84 g/mol |
| Exact Mass | 549.42 |
| IUPAC Name | [5-(azocan-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]-cyclohexylmethanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCCCCC1 |
| InChI | InChI=1S/C36H55NO3/c1-32-16-13-27(38)23-34(32)19-20-36(28(24-34)31(39)26-11-7-6-8-12-26)29(32)14-17-33(2)30(36)15-18-35(33,40)25-37-21-9-4-3-5-10-22-37/h19-20,24,26-27,29-30,38,40H,3-18,21-23,25H2,1-2H3 |
| InChIKey | XJJCKHYUAUORCZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|