About 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate
3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate (PubChem CID 4232774) has the molecular formula C7H9N2O3-
and a molecular weight of 169.16 g/mol. Its IUPAC name is 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate.
Molecular Properties
| Compound Name | 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate |
| PubChem CID | 4232774 |
| Molecular Formula | C7H9N2O3- |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate |
| SMILES | O=C([O-])CCC1=CCC(=O)NN1 |
| InChI | InChI=1S/C7H10N2O3/c10-6-3-1-5(8-9-6)2-4-7(11)12/h1,8H,2-4H2,(H,9,10)(H,11,12)/p-1 |
| InChIKey | WEWGVODNYSASSF-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate?
The IUPAC name of 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate (CID 4232774) is 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate.
What is the SMILES notation for 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate?
The canonical SMILES for 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate is O=C([O-])CCC1=CCC(=O)NN1.
What is the InChIKey of 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate?
The InChIKey is WEWGVODNYSASSF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10N2O3/c10-6-3-1-5(8-9-6)2-4-7(11)12/h1,8H,2-4H2,(H,9,10)(H,11,12)/p-1.
What are the key properties of 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate?
3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate has a molecular weight of 169.16 g/mol, XLogP of -1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-oxo-2,4-dihydro-1H-pyridazin-6-yl)propanoate is sourced from PubChem (CID 4232774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).