C20H18BrN3OS — CID 4233609
1-(4-bromophenyl)-2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 4233609) has the molecular formula C20H18BrN3OS and a molecular weight of 428.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-bromophenyl)-2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 4233609 |
| Molecular Formula | C20H18BrN3OS |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 1-(4-bromophenyl)-2-[[5-(2-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(SCC(=O)c2ccc(Br)cc2)nnc1-c1ccccc1C |
| InChI | InChI=1S/C20H18BrN3OS/c1-3-12-24-19(17-7-5-4-6-14(17)2)22-23-20(24)26-13-18(25)15-8-10-16(21)11-9-15/h3-11H,1,12-13H2,2H3 |
| InChIKey | OFEMHJDDCBVXDD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|