C17H17N3O3S — CID 42345508
N-(4-hydroxyphenyl)-N,1-dimethyl-3-phenylpyrazole-4-sulfonamide (PubChem CID 42345508) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-N,1-dimethyl-3-phenylpyrazole-4-sulfonamide.
| Compound Name | N-(4-hydroxyphenyl)-N,1-dimethyl-3-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42345508 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(4-hydroxyphenyl)-N,1-dimethyl-3-phenylpyrazole-4-sulfonamide |
| SMILES | CN(c1ccc(O)cc1)S(=O)(=O)c1cn(C)nc1-c1ccccc1 |
| InChI | InChI=1S/C17H17N3O3S/c1-19-12-16(17(18-19)13-6-4-3-5-7-13)24(22,23)20(2)14-8-10-15(21)11-9-14/h3-12,21H,1-2H3 |
| InChIKey | VJNUILRZVUUWLE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |