C23H24F2N2O2 — CID 42345880
(1S,5S,7S)-7-(3,5-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 42345880) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is (1S,5S,7S)-7-(3,5-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-7-(3,5-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 42345880 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (1S,5S,7S)-7-(3,5-difluorophenyl)-3-[(4-methoxyphenyl)methyl]-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | COc1ccc(CN2C[C@@H]3C[C@@H](c4cc(F)cc(F)c4)N4CCC[C@@]34C2=O)cc1 |
| InChI | InChI=1S/C23H24F2N2O2/c1-29-20-5-3-15(4-6-20)13-26-14-17-11-21(16-9-18(24)12-19(25)10-16)27-8-2-7-23(17,27)22(26)28/h3-6,9-10,12,17,21H,2,7-8,11,13-14H2,1H3/t17-,21-,23-/m0/s1 |
| InChIKey | XMJBEZNCATVLJN-HYVJGQCMSA-N |
| XLogP | 3.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |