C23H33NO4 — CID 42346806
3-cyclohexyl-1-[(3R)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]propan-1-one (PubChem CID 42346806) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(3R)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-cyclohexyl-1-[(3R)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42346806 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 3-cyclohexyl-1-[(3R)-3-(3,4-dimethoxybenzoyl)piperidin-1-yl]propan-1-one |
| SMILES | COc1ccc(C(=O)[C@@H]2CCCN(C(=O)CCC3CCCCC3)C2)cc1OC |
| InChI | InChI=1S/C23H33NO4/c1-27-20-12-11-18(15-21(20)28-2)23(26)19-9-6-14-24(16-19)22(25)13-10-17-7-4-3-5-8-17/h11-12,15,17,19H,3-10,13-14,16H2,1-2H3/t19-/m1/s1 |
| InChIKey | DWSRLMAQINEXHJ-LJQANCHMSA-N |
| XLogP | 4.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |