About benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate
benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 4234707) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| PubChem CID | 4234707 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CCCN2C(=O)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-15-10-11-18(16(2)13-15)22-20(24)19-9-6-12-23(19)21(25)26-14-17-7-4-3-5-8-17/h3-5,7-8,10-11,13,19H,6,9,12,14H2,1-2H3,(H,22,24) |
| InChIKey | MUYBATUIZLNVLA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate (CID 4234707) is benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate is Cc1ccc(NC(=O)C2CCCN2C(=O)OCc2ccccc2)c(C)c1.
What is the InChIKey of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
The InChIKey is MUYBATUIZLNVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-15-10-11-18(16(2)13-15)22-20(24)19-9-6-12-23(19)21(25)26-14-17-7-4-3-5-8-17/h3-5,7-8,10-11,13,19H,6,9,12,14H2,1-2H3,(H,22,24).
What are the key properties of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate?
benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate has a molecular weight of 352.43 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(2,4-dimethylphenyl)carbamoyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 4234707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).