C28H26N2O3 — CID 4234759
[4-[9-(4-methylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate (PubChem CID 4234759) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is [4-[9-(4-methylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate.
| Compound Name | [4-[9-(4-methylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate |
|---|---|
| PubChem CID | 4234759 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [4-[9-(4-methylphenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(C)cc2)C3)cc1 |
| InChI | InChI=1S/C28H26N2O3/c1-17-7-9-19(10-8-17)21-15-25-27(26(32)16-21)28(30-24-6-4-3-5-23(24)29-25)20-11-13-22(14-12-20)33-18(2)31/h3-14,21,28-30H,15-16H2,1-2H3 |
| InChIKey | XTQWHRDCJCPYIW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|