C19H18N2O6S — CID 42347627
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]benzamide (PubChem CID 42347627) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]benzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]benzamide |
|---|---|
| PubChem CID | 42347627 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(4R)-4-methyl-1,1,3-trioxo-1,2-thiazolidin-2-yl]benzamide |
| SMILES | C[C@H]1CS(=O)(=O)N(c2cccc(C(=O)Nc3ccc4c(c3)OCCO4)c2)C1=O |
| InChI | InChI=1S/C19H18N2O6S/c1-12-11-28(24,25)21(19(12)23)15-4-2-3-13(9-15)18(22)20-14-5-6-16-17(10-14)27-8-7-26-16/h2-6,9-10,12H,7-8,11H2,1H3,(H,20,22)/t12-/m0/s1 |
| InChIKey | OUDQRHTZNKPMGC-LBPRGKRZSA-N |
| XLogP | 2.02 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |