C24H41N3O2 — CID 42355782
(3S)-1-cycloheptyl-6-oxo-N-[(1-piperidin-1-ylcyclopentyl)methyl]piperidine-3-carboxamide (PubChem CID 42355782) has the molecular formula C24H41N3O2 and a molecular weight of 403.61 g/mol. Its IUPAC name is (3S)-1-cycloheptyl-6-oxo-N-[(1-piperidin-1-ylcyclopentyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-cycloheptyl-6-oxo-N-[(1-piperidin-1-ylcyclopentyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42355782 |
| Molecular Formula | C24H41N3O2 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.32 |
| IUPAC Name | (3S)-1-cycloheptyl-6-oxo-N-[(1-piperidin-1-ylcyclopentyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCC1(N2CCCCC2)CCCC1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C24H41N3O2/c28-22-13-12-20(18-27(22)21-10-4-1-2-5-11-21)23(29)25-19-24(14-6-7-15-24)26-16-8-3-9-17-26/h20-21H,1-19H2,(H,25,29)/t20-/m0/s1 |
| InChIKey | JBQWEWSFACOECP-FQEVSTJZSA-N |
| XLogP | 3.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |