About 1,2-diphenylethene-1,2-diamine
1,2-diphenylethene-1,2-diamine (PubChem CID 4235600) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,2-diphenylethene-1,2-diamine.
Molecular Properties
| Compound Name | 1,2-diphenylethene-1,2-diamine |
| PubChem CID | 4235600 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1,2-diphenylethene-1,2-diamine |
| SMILES | NC(=C(N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H,15-16H2 |
| InChIKey | TXVWTOBHDDIASC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylethene-1,2-diamine?
The IUPAC name of 1,2-diphenylethene-1,2-diamine (CID 4235600) is 1,2-diphenylethene-1,2-diamine.
What is the SMILES notation for 1,2-diphenylethene-1,2-diamine?
The canonical SMILES for 1,2-diphenylethene-1,2-diamine is NC(=C(N)c1ccccc1)c1ccccc1.
What is the InChIKey of 1,2-diphenylethene-1,2-diamine?
The InChIKey is TXVWTOBHDDIASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H,15-16H2.
What are the key properties of 1,2-diphenylethene-1,2-diamine?
1,2-diphenylethene-1,2-diamine has a molecular weight of 210.28 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylethene-1,2-diamine is sourced from PubChem (CID 4235600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).