C22H25N3O3 — CID 42357494
(5S)-2-(1-oxidopyridin-1-ium-4-carbonyl)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 42357494) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (5S)-2-(1-oxidopyridin-1-ium-4-carbonyl)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | (5S)-2-(1-oxidopyridin-1-ium-4-carbonyl)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 42357494 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (5S)-2-(1-oxidopyridin-1-ium-4-carbonyl)-7-(2-phenylethyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C(c1cc[n+]([O-])cc1)N1CC[C@@]2(CCCN(CCc3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C22H25N3O3/c26-20(19-8-14-25(28)15-9-19)24-16-11-22(17-24)10-4-12-23(21(22)27)13-7-18-5-2-1-3-6-18/h1-3,5-6,8-9,14-15H,4,7,10-13,16-17H2/t22-/m0/s1 |
| InChIKey | MJIQDYGPAYXCPT-QFIPXVFZSA-N |
| XLogP | 2.02 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|