C9H10F9NO — CID 4236019
N-butyl-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide (PubChem CID 4236019) has the molecular formula C9H10F9NO and a molecular weight of 319.17 g/mol. Its IUPAC name is N-butyl-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide.
| Compound Name | N-butyl-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 4236019 |
| Molecular Formula | C9H10F9NO |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-butyl-3,3,3-trifluoro-2,2-bis(trifluoromethyl)propanamide |
| SMILES | CCCCNC(=O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9NO/c1-2-3-4-19-5(20)6(7(10,11)12,8(13,14)15)9(16,17)18/h2-4H2,1H3,(H,19,20) |
| InChIKey | HJPBZSGWGKVYAW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|