C20H22ClNO2 — CID 42361324
(4-chlorophenyl)-[(3R)-1-[(2-methoxyphenyl)methyl]piperidin-3-yl]methanone (PubChem CID 42361324) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is (4-chlorophenyl)-[(3R)-1-[(2-methoxyphenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(3R)-1-[(2-methoxyphenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42361324 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (4-chlorophenyl)-[(3R)-1-[(2-methoxyphenyl)methyl]piperidin-3-yl]methanone |
| SMILES | COc1ccccc1CN1CCC[C@@H](C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H22ClNO2/c1-24-19-7-3-2-5-16(19)13-22-12-4-6-17(14-22)20(23)15-8-10-18(21)11-9-15/h2-3,5,7-11,17H,4,6,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | XXSAZYMLNJODET-QGZVFWFLSA-N |
| XLogP | 4.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |