C25H24N6O2 — CID 42362401
5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrazole-4-carboxamide (PubChem CID 42362401) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42362401 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 5-cyclopropyl-1-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-yl)-N-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrazole-4-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2cnn(-c3ncc4c(n3)-c3ccccc3CCC4)c2C2CC2)on1 |
| InChI | InChI=1S/C25H24N6O2/c1-15-11-19(33-30-15)13-26-24(32)21-14-28-31(23(21)17-9-10-17)25-27-12-18-7-4-6-16-5-2-3-8-20(16)22(18)29-25/h2-3,5,8,11-12,14,17H,4,6-7,9-10,13H2,1H3,(H,26,32) |
| InChIKey | XVANTCTXWWDJOQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |