C19H16F2N4OS — CID 42363493
(E)-3-(3-fluorophenyl)-N-[[4-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide (PubChem CID 42363493) has the molecular formula C19H16F2N4OS and a molecular weight of 386.43 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[[4-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[[4-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 42363493 |
| Molecular Formula | C19H16F2N4OS |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[[4-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]methyl]prop-2-enamide |
| SMILES | CSc1nnc(CNC(=O)/C=C/c2cccc(F)c2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F2N4OS/c1-27-19-24-23-17(25(19)16-8-6-14(20)7-9-16)12-22-18(26)10-5-13-3-2-4-15(21)11-13/h2-11H,12H2,1H3,(H,22,26)/b10-5+ |
| InChIKey | IQZIFXYISIYZHY-BJMVGYQFSA-N |
| XLogP | 3.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|