C28H28N4O3 — CID 42369423
1-[7-[(1R)-1-hydroxy-2,2-diphenylethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone (PubChem CID 42369423) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-[7-[(1R)-1-hydroxy-2,2-diphenylethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone.
| Compound Name | 1-[7-[(1R)-1-hydroxy-2,2-diphenylethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone |
|---|---|
| PubChem CID | 42369423 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-[7-[(1R)-1-hydroxy-2,2-diphenylethyl]-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]-2-(5-methyl-1H-1,2,4-triazol-3-yl)ethanone |
| SMILES | Cc1nc(CC(=O)N2CCOc3ccc([C@H](O)C(c4ccccc4)c4ccccc4)cc3C2)n[nH]1 |
| InChI | InChI=1S/C28H28N4O3/c1-19-29-25(31-30-19)17-26(33)32-14-15-35-24-13-12-22(16-23(24)18-32)28(34)27(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,16,27-28,34H,14-15,17-18H2,1H3,(H,29,30,31)/t28-/m0/s1 |
| InChIKey | MQYXJUCNCIMZRB-NDEPHWFRSA-N |
| XLogP | 3.94 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |