C26H31FN2O2 — CID 42369508
3-fluoro-N-[(1R,2R)-2-methoxy-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]benzamide (PubChem CID 42369508) has the molecular formula C26H31FN2O2 and a molecular weight of 422.54 g/mol. Its IUPAC name is 3-fluoro-N-[(1R,2R)-2-methoxy-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]benzamide.
| Compound Name | 3-fluoro-N-[(1R,2R)-2-methoxy-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]benzamide |
|---|---|
| PubChem CID | 42369508 |
| Molecular Formula | C26H31FN2O2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-fluoro-N-[(1R,2R)-2-methoxy-1'-[(E)-2-methylbut-2-enyl]spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]benzamide |
| SMILES | C/C=C(\C)CN1CCC2(CC1)c1ccccc1[C@@H](NC(=O)c1cccc(F)c1)[C@@H]2OC |
| InChI | InChI=1S/C26H31FN2O2/c1-4-18(2)17-29-14-12-26(13-15-29)22-11-6-5-10-21(22)23(24(26)31-3)28-25(30)19-8-7-9-20(27)16-19/h4-11,16,23-24H,12-15,17H2,1-3H3,(H,28,30)/b18-4+/t23-,24+/m1/s1 |
| InChIKey | PPECFEBJECAIDO-AMMRNTOFSA-N |
| XLogP | 4.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|