C22H23N3O3S2 — CID 42375017
N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenyl-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 42375017) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenyl-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenyl-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 42375017 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-phenyl-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)N(c2ccccc2)[C@H]2CCS(=O)(=O)C2)nc2ccccc21 |
| InChI | InChI=1S/C22H23N3O3S2/c1-2-13-24-20-11-7-6-10-19(20)23-22(24)29-15-21(26)25(17-8-4-3-5-9-17)18-12-14-30(27,28)16-18/h2-11,18H,1,12-16H2/t18-/m0/s1 |
| InChIKey | KJQJYVPKZSGHOZ-SFHVURJKSA-N |
| XLogP | 3.53 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|