C24H27N5O2S — CID 42375449
N-(3-ethylphenyl)-2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide (PubChem CID 42375449) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 42375449 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-(3-ethylphenyl)-2-[(5-oxo-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanyl]acetamide |
| SMILES | CCCCCn1c(=O)c2ccccc2n2c(SCC(=O)Nc3cccc(CC)c3)nnc12 |
| InChI | InChI=1S/C24H27N5O2S/c1-3-5-8-14-28-22(31)19-12-6-7-13-20(19)29-23(28)26-27-24(29)32-16-21(30)25-18-11-9-10-17(4-2)15-18/h6-7,9-13,15H,3-5,8,14,16H2,1-2H3,(H,25,30) |
| InChIKey | JGYUDKHUZNOBSX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|