C20H18N2O2 — CID 42377162
(2R)-2-[(2-naphthalen-2-ylacetyl)amino]-2-phenylacetamide (PubChem CID 42377162) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2R)-2-[(2-naphthalen-2-ylacetyl)amino]-2-phenylacetamide.
| Compound Name | (2R)-2-[(2-naphthalen-2-ylacetyl)amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 42377162 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (2R)-2-[(2-naphthalen-2-ylacetyl)amino]-2-phenylacetamide |
| SMILES | NC(=O)[C@H](NC(=O)Cc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O2/c21-20(24)19(16-7-2-1-3-8-16)22-18(23)13-14-10-11-15-6-4-5-9-17(15)12-14/h1-12,19H,13H2,(H2,21,24)(H,22,23)/t19-/m1/s1 |
| InChIKey | OJVQLPGCQDDYNF-LJQANCHMSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |