C27H26N4O2 — CID 42377969
(1-benzhydryltriazol-4-yl)-[(2R)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone (PubChem CID 42377969) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (1-benzhydryltriazol-4-yl)-[(2R)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone.
| Compound Name | (1-benzhydryltriazol-4-yl)-[(2R)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42377969 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (1-benzhydryltriazol-4-yl)-[(2R)-2-(2-methoxyphenyl)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccccc1[C@H]1CCCN1C(=O)c1cn(C(c2ccccc2)c2ccccc2)nn1 |
| InChI | InChI=1S/C27H26N4O2/c1-33-25-17-9-8-15-22(25)24-16-10-18-30(24)27(32)23-19-31(29-28-23)26(20-11-4-2-5-12-20)21-13-6-3-7-14-21/h2-9,11-15,17,19,24,26H,10,16,18H2,1H3/t24-/m1/s1 |
| InChIKey | OQPXMTZYGLZRLX-XMMPIXPASA-N |
| XLogP | 4.90 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |