C17H28N4OS — CID 42378253
[(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 42378253) has the molecular formula C17H28N4OS and a molecular weight of 336.50 g/mol. Its IUPAC name is [(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | [(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 42378253 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [(4aR,8aR)-6-(3-methylbutyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCC[C@@H]2CN(CCC(C)C)CC[C@H]21 |
| InChI | InChI=1S/C17H28N4OS/c1-12(2)6-9-20-10-7-15-14(11-20)5-4-8-21(15)17(22)16-13(3)18-19-23-16/h12,14-15H,4-11H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | QHCXFBPUEUELRM-HUUCEWRRSA-N |
| XLogP | 2.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |