C21H29ClN2O4 — CID 42378608
(5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(4S)-2,2-dimethyloxan-4-yl]pyrrolidin-2-one (PubChem CID 42378608) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(4S)-2,2-dimethyloxan-4-yl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(4S)-2,2-dimethyloxan-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42378608 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(4S)-2,2-dimethyloxan-4-yl]pyrrolidin-2-one |
| SMILES | CC1(C)C[C@@H](N2C(=O)CC[C@H]2CCNCc2cc3c(cc2Cl)OCO3)CCO1 |
| InChI | InChI=1S/C21H29ClN2O4/c1-21(2)11-16(6-8-28-21)24-15(3-4-20(24)25)5-7-23-12-14-9-18-19(10-17(14)22)27-13-26-18/h9-10,15-16,23H,3-8,11-13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | SFIHXFZBAUZLMB-HOTGVXAUSA-N |
| XLogP | 3.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|