C21H29N3O4 — CID 42380861
ethyl 4-[(3S)-6-oxo-1-(2-phenylethyl)piperidine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 42380861) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 4-[(3S)-6-oxo-1-(2-phenylethyl)piperidine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(3S)-6-oxo-1-(2-phenylethyl)piperidine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42380861 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | ethyl 4-[(3S)-6-oxo-1-(2-phenylethyl)piperidine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@H]2CCC(=O)N(CCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-2-28-21(27)23-14-12-22(13-15-23)20(26)18-8-9-19(25)24(16-18)11-10-17-6-4-3-5-7-17/h3-7,18H,2,8-16H2,1H3/t18-/m0/s1 |
| InChIKey | APQUGCKROGXRRI-SFHVURJKSA-N |
| XLogP | 1.77 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |