C23H29FN4O5S — CID 4238182
3-(diethylsulfamoyl)-N-[1-[2-(2-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 4238182) has the molecular formula C23H29FN4O5S and a molecular weight of 492.57 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[1-[2-(2-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[1-[2-(2-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 4238182 |
| Molecular Formula | C23H29FN4O5S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[1-[2-(2-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NC(C(=O)NNC(=O)c2ccccc2F)C(C)C)c1 |
| InChI | InChI=1S/C23H29FN4O5S/c1-5-28(6-2)34(32,33)17-11-9-10-16(14-17)21(29)25-20(15(3)4)23(31)27-26-22(30)18-12-7-8-13-19(18)24/h7-15,20H,5-6H2,1-4H3,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | URRPJXYGHHXNCS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|