C21H26N4O4S — CID 42383402
3-[5-[(2,5-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide (PubChem CID 42383402) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-[5-[(2,5-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide.
| Compound Name | 3-[5-[(2,5-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide |
|---|---|
| PubChem CID | 42383402 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-[5-[(2,5-dimethoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl]-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]propanamide |
| SMILES | COc1ccc(OC)c(Cc2nnc(CCC(=O)NCCCc3scnc3C)o2)c1 |
| InChI | InChI=1S/C21H26N4O4S/c1-14-18(30-13-23-14)5-4-10-22-19(26)8-9-20-24-25-21(29-20)12-15-11-16(27-2)6-7-17(15)28-3/h6-7,11,13H,4-5,8-10,12H2,1-3H3,(H,22,26) |
| InChIKey | SGOHRPDULIVLRP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|