C23H31ClN2O2 — CID 42383425
4-chloro-2-[[[(3R)-1-[2-(4-methoxyphenyl)ethyl]piperidin-3-yl]methyl-methylamino]methyl]phenol (PubChem CID 42383425) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 4-chloro-2-[[[(3R)-1-[2-(4-methoxyphenyl)ethyl]piperidin-3-yl]methyl-methylamino]methyl]phenol.
| Compound Name | 4-chloro-2-[[[(3R)-1-[2-(4-methoxyphenyl)ethyl]piperidin-3-yl]methyl-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 42383425 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 4-chloro-2-[[[(3R)-1-[2-(4-methoxyphenyl)ethyl]piperidin-3-yl]methyl-methylamino]methyl]phenol |
| SMILES | COc1ccc(CCN2CCC[C@H](CN(C)Cc3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C23H31ClN2O2/c1-25(17-20-14-21(24)7-10-23(20)27)15-19-4-3-12-26(16-19)13-11-18-5-8-22(28-2)9-6-18/h5-10,14,19,27H,3-4,11-13,15-17H2,1-2H3/t19-/m1/s1 |
| InChIKey | SZSIGUSJAAIMHM-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|