C18H18ClN3O3 — CID 42384857
N-[(3S)-1-[2-(3-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 42384857) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is N-[(3S)-1-[2-(3-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[(3S)-1-[2-(3-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 42384857 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[(3S)-1-[2-(3-chlorophenyl)ethyl]-5-oxopyrrolidin-3-yl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | O=C(N[C@H]1CC(=O)N(CCc2cccc(Cl)c2)C1)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C18H18ClN3O3/c19-15-5-1-3-13(9-15)6-8-21-12-16(10-17(21)23)20-18(24)14-4-2-7-22(25)11-14/h1-5,7,9,11,16H,6,8,10,12H2,(H,20,24)/t16-/m0/s1 |
| InChIKey | QBKXEYVCQNRHQN-INIZCTEOSA-N |
| XLogP | 1.55 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|